C11H19NO4 — CID 11253192
ethyl N-[(1S,4R)-4-hydroxycyclopent-2-en-1-yl]-N-(3-hydroxypropyl)carbamate (PubChem CID 11253192) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is ethyl N-[(1S,4R)-4-hydroxycyclopent-2-en-1-yl]-N-(3-hydroxypropyl)carbamate.
| Compound Name | ethyl N-[(1S,4R)-4-hydroxycyclopent-2-en-1-yl]-N-(3-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 11253192 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | ethyl N-[(1S,4R)-4-hydroxycyclopent-2-en-1-yl]-N-(3-hydroxypropyl)carbamate |
| SMILES | CCOC(=O)N(CCCO)[C@@H]1C=C[C@H](O)C1 |
| InChI | InChI=1S/C11H19NO4/c1-2-16-11(15)12(6-3-7-13)9-4-5-10(14)8-9/h4-5,9-10,13-14H,2-3,6-8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | SYSSUJXFYAQHCY-ZJUUUORDSA-N |
| XLogP | 0.52 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|