C16H19N3O2 — CID 112532976
4-ethoxy-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)benzamide (PubChem CID 112532976) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-ethoxy-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)benzamide.
| Compound Name | 4-ethoxy-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)benzamide |
|---|---|
| PubChem CID | 112532976 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-ethoxy-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)benzamide |
| SMILES | CCOc1ccc(C(=O)NC2CCn3ccnc3C2)cc1 |
| InChI | InChI=1S/C16H19N3O2/c1-2-21-14-5-3-12(4-6-14)16(20)18-13-7-9-19-10-8-17-15(19)11-13/h3-6,8,10,13H,2,7,9,11H2,1H3,(H,18,20) |
| InChIKey | SKLDFGGWTVMFJY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |