C12H19NO3 — CID 112533289
2,2-dimethyl-1-(oxane-4-carbonyl)pyrrolidin-3-one (PubChem CID 112533289) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2,2-dimethyl-1-(oxane-4-carbonyl)pyrrolidin-3-one.
| Compound Name | 2,2-dimethyl-1-(oxane-4-carbonyl)pyrrolidin-3-one |
|---|---|
| PubChem CID | 112533289 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 2,2-dimethyl-1-(oxane-4-carbonyl)pyrrolidin-3-one |
| SMILES | CC1(C)C(=O)CCN1C(=O)C1CCOCC1 |
| InChI | InChI=1S/C12H19NO3/c1-12(2)10(14)3-6-13(12)11(15)9-4-7-16-8-5-9/h9H,3-8H2,1-2H3 |
| InChIKey | WNIMCGSZLZDCBS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |