C14H20O3 — CID 11253346
2,2,4,4-tetramethyl-6-(2-methylpropylidene)cyclohexane-1,3,5-trione (PubChem CID 11253346) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-6-(2-methylpropylidene)cyclohexane-1,3,5-trione.
| Compound Name | 2,2,4,4-tetramethyl-6-(2-methylpropylidene)cyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 11253346 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2,2,4,4-tetramethyl-6-(2-methylpropylidene)cyclohexane-1,3,5-trione |
| SMILES | CC(C)C=C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C14H20O3/c1-8(2)7-9-10(15)13(3,4)12(17)14(5,6)11(9)16/h7-8H,1-6H3 |
| InChIKey | HUPVCNXRLVJGCP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|