C15H26O2 — CID 11253414
[(2S,3S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]methanol (PubChem CID 11253414) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is [(2S,3S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11253414 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | [(2S,3S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]methanol |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@]1(C)O[C@H]1CO |
| InChI | InChI=1S/C15H26O2/c1-12(2)7-5-8-13(3)9-6-10-15(4)14(11-16)17-15/h7,9,14,16H,5-6,8,10-11H2,1-4H3/b13-9+/t14-,15-/m0/s1 |
| InChIKey | QMBUSAARJPUREI-FQSSWDBKSA-N |
| XLogP | 3.61 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|