C13H22O2Si — CID 11253416
(E,2R,3R)-2-[(2S)-oxiran-2-yl]-8-trimethylsilyloct-5-en-7-yn-3-ol (PubChem CID 11253416) has the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. Its IUPAC name is (E,2R,3R)-2-[(2S)-oxiran-2-yl]-8-trimethylsilyloct-5-en-7-yn-3-ol.
| Compound Name | (E,2R,3R)-2-[(2S)-oxiran-2-yl]-8-trimethylsilyloct-5-en-7-yn-3-ol |
|---|---|
| PubChem CID | 11253416 |
| Molecular Formula | C13H22O2Si |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (E,2R,3R)-2-[(2S)-oxiran-2-yl]-8-trimethylsilyloct-5-en-7-yn-3-ol |
| SMILES | C[C@H]([C@H](O)C/C=C/C#C[Si](C)(C)C)[C@H]1CO1 |
| InChI | InChI=1S/C13H22O2Si/c1-11(13-10-15-13)12(14)8-6-5-7-9-16(2,3)4/h5-6,11-14H,8,10H2,1-4H3/b6-5+/t11-,12-,13-/m1/s1 |
| InChIKey | NNVGXFRKUQPTKK-ZAGQHCIPSA-N |
| XLogP | 2.21 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|