C13H20ClNO — CID 11253507
(1S,4R,9aS)-4-[(Z)-3-chloroprop-2-enyl]-1-methyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one (PubChem CID 11253507) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is (1S,4R,9aS)-4-[(Z)-3-chloroprop-2-enyl]-1-methyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one.
| Compound Name | (1S,4R,9aS)-4-[(Z)-3-chloroprop-2-enyl]-1-methyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one |
|---|---|
| PubChem CID | 11253507 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (1S,4R,9aS)-4-[(Z)-3-chloroprop-2-enyl]-1-methyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one |
| SMILES | C[C@@H]1C(=O)C[C@@H](C/C=C\Cl)N2CCCC[C@@H]12 |
| InChI | InChI=1S/C13H20ClNO/c1-10-12-6-2-3-8-15(12)11(5-4-7-14)9-13(10)16/h4,7,10-12H,2-3,5-6,8-9H2,1H3/b7-4-/t10-,11+,12-/m0/s1 |
| InChIKey | VGYXVIBVBMZRLJ-OVBAQPLKSA-N |
| XLogP | 2.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |