About N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide
N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide (PubChem CID 112537434) has the molecular formula C19H19BrN2O2
and a molecular weight of 387.28 g/mol. Its IUPAC name is N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide.
Molecular Properties
| Compound Name | N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide |
| PubChem CID | 112537434 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide |
| SMILES | CC(=O)N(C(=O)Cc1ccc(C)cc1)c1cc(Br)cc2c1NCC2 |
| InChI | InChI=1S/C19H19BrN2O2/c1-12-3-5-14(6-4-12)9-18(24)22(13(2)23)17-11-16(20)10-15-7-8-21-19(15)17/h3-6,10-11,21H,7-9H2,1-2H3 |
| InChIKey | AMPKDTJZKUBDPP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide?
The IUPAC name of N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide (CID 112537434) is N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide.
What is the SMILES notation for N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide?
The canonical SMILES for N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide is CC(=O)N(C(=O)Cc1ccc(C)cc1)c1cc(Br)cc2c1NCC2.
What is the InChIKey of N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide?
The InChIKey is AMPKDTJZKUBDPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrN2O2/c1-12-3-5-14(6-4-12)9-18(24)22(13(2)23)17-11-16(20)10-15-7-8-21-19(15)17/h3-6,10-11,21H,7-9H2,1-2H3.
What are the key properties of N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide?
N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide has a molecular weight of 387.28 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-(4-methylphenyl)acetamide is sourced from PubChem (CID 112537434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).