About 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane
5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane (PubChem CID 11253781) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane.
Molecular Properties
| Compound Name | 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane |
| PubChem CID | 11253781 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane |
| SMILES | CC1=CCC(C(C)CC2OCC(C)(C)CO2)CC1 |
| InChI | InChI=1S/C16H28O2/c1-12-5-7-14(8-6-12)13(2)9-15-17-10-16(3,4)11-18-15/h5,13-15H,6-11H2,1-4H3 |
| InChIKey | XQXHMOAUUHSXEI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane?
The IUPAC name of 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane (CID 11253781) is 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane.
What is the SMILES notation for 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane?
The canonical SMILES for 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane is CC1=CCC(C(C)CC2OCC(C)(C)CO2)CC1.
What is the InChIKey of 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane?
The InChIKey is XQXHMOAUUHSXEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2/c1-12-5-7-14(8-6-12)13(2)9-15-17-10-16(3,4)11-18-15/h5,13-15H,6-11H2,1-4H3.
What are the key properties of 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane?
5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane has a molecular weight of 252.40 g/mol, XLogP of 4.16, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-dioxane is sourced from PubChem (CID 11253781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).