About 4-(4-nitrophenyl)-1,3-selenazole
4-(4-nitrophenyl)-1,3-selenazole (PubChem CID 11253789) has the molecular formula C9H6N2O2Se
and a molecular weight of 253.12 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-1,3-selenazole.
Molecular Properties
| Compound Name | 4-(4-nitrophenyl)-1,3-selenazole |
| PubChem CID | 11253789 |
| Molecular Formula | C9H6N2O2Se |
| Molecular Weight | 253.12 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 4-(4-nitrophenyl)-1,3-selenazole |
| SMILES | O=[N+]([O-])c1ccc(-c2c[se]cn2)cc1 |
| InChI | InChI=1S/C9H6N2O2Se/c12-11(13)8-3-1-7(2-4-8)9-5-14-6-10-9/h1-6H |
| InChIKey | SXHQIFQCCXUYCV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.12 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-nitrophenyl)-1,3-selenazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-nitrophenyl)-1,3-selenazole?
The IUPAC name of 4-(4-nitrophenyl)-1,3-selenazole (CID 11253789) is 4-(4-nitrophenyl)-1,3-selenazole.
What is the SMILES notation for 4-(4-nitrophenyl)-1,3-selenazole?
The canonical SMILES for 4-(4-nitrophenyl)-1,3-selenazole is O=[N+]([O-])c1ccc(-c2c[se]cn2)cc1.
What is the InChIKey of 4-(4-nitrophenyl)-1,3-selenazole?
The InChIKey is SXHQIFQCCXUYCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2Se/c12-11(13)8-3-1-7(2-4-8)9-5-14-6-10-9/h1-6H.
What are the key properties of 4-(4-nitrophenyl)-1,3-selenazole?
4-(4-nitrophenyl)-1,3-selenazole has a molecular weight of 253.12 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-nitrophenyl)-1,3-selenazole is sourced from PubChem (CID 11253789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).