C21H34N2O2 — CID 112538815
tert-butyl 4-[2-amino-1-(4-propan-2-ylphenyl)ethyl]piperidine-1-carboxylate (PubChem CID 112538815) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is tert-butyl 4-[2-amino-1-(4-propan-2-ylphenyl)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-amino-1-(4-propan-2-ylphenyl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 112538815 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | tert-butyl 4-[2-amino-1-(4-propan-2-ylphenyl)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)c1ccc(C(CN)C2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H34N2O2/c1-15(2)16-6-8-17(9-7-16)19(14-22)18-10-12-23(13-11-18)20(24)25-21(3,4)5/h6-9,15,18-19H,10-14,22H2,1-5H3 |
| InChIKey | CAIIJURBWVNBLS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |