About zinc bis(dihydrogen phosphate)
zinc bis(dihydrogen phosphate) (PubChem CID 11253952) has the molecular formula H4O8P2Zn
and a molecular weight of 259.36 g/mol. Its IUPAC name is zinc bis(dihydrogen phosphate).
Molecular Properties
| Compound Name | zinc bis(dihydrogen phosphate) |
| PubChem CID | 11253952 |
| Molecular Formula | H4O8P2Zn |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 257.87 |
| IUPAC Name | zinc bis(dihydrogen phosphate) |
| SMILES | O=P([O-])(O)O.O=P([O-])(O)O.[Zn+2] |
| InChI | InChI=1S/2H3O4P.Zn/c2*1-5(2,3)4;/h2*(H3,1,2,3,4);/q;;+2/p-2 |
| InChIKey | MFXMOUUKFMDYLM-UHFFFAOYSA-L |
| XLogP | -3.12 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(dihydrogen phosphate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(dihydrogen phosphate)?
The IUPAC name of zinc bis(dihydrogen phosphate) (CID 11253952) is zinc bis(dihydrogen phosphate).
What is the SMILES notation for zinc bis(dihydrogen phosphate)?
The canonical SMILES for zinc bis(dihydrogen phosphate) is O=P([O-])(O)O.O=P([O-])(O)O.[Zn+2].
What is the InChIKey of zinc bis(dihydrogen phosphate)?
The InChIKey is MFXMOUUKFMDYLM-UHFFFAOYSA-L. The full InChI is InChI=1S/2H3O4P.Zn/c2*1-5(2,3)4;/h2*(H3,1,2,3,4);/q;;+2/p-2.
What are the key properties of zinc bis(dihydrogen phosphate)?
zinc bis(dihydrogen phosphate) has a molecular weight of 259.36 g/mol, XLogP of -3.12, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(dihydrogen phosphate) is sourced from PubChem (CID 11253952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).