C16H25ClN2O3 — CID 112540462
2-chloro-6-ethoxy-4-[1-(4-ethylpiperazin-1-yl)-2-hydroxyethyl]phenol (PubChem CID 112540462) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is 2-chloro-6-ethoxy-4-[1-(4-ethylpiperazin-1-yl)-2-hydroxyethyl]phenol.
| Compound Name | 2-chloro-6-ethoxy-4-[1-(4-ethylpiperazin-1-yl)-2-hydroxyethyl]phenol |
|---|---|
| PubChem CID | 112540462 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-chloro-6-ethoxy-4-[1-(4-ethylpiperazin-1-yl)-2-hydroxyethyl]phenol |
| SMILES | CCOc1cc(C(CO)N2CCN(CC)CC2)cc(Cl)c1O |
| InChI | InChI=1S/C16H25ClN2O3/c1-3-18-5-7-19(8-6-18)14(11-20)12-9-13(17)16(21)15(10-12)22-4-2/h9-10,14,20-21H,3-8,11H2,1-2H3 |
| InChIKey | AROPKFVNPJKWMZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |