About 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol
4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol (PubChem CID 112540836) has the molecular formula C18H26N2O
and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol.
Molecular Properties
| Compound Name | 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol |
| PubChem CID | 112540836 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol |
| SMILES | CC(O)CCc1cn(C)c2cc3c(cc12)CN(C(C)C)C3 |
| InChI | InChI=1S/C18H26N2O/c1-12(2)20-10-15-7-17-14(6-5-13(3)21)9-19(4)18(17)8-16(15)11-20/h7-9,12-13,21H,5-6,10-11H2,1-4H3 |
| InChIKey | MNGLTTSYJDPYNF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol?
The IUPAC name of 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol (CID 112540836) is 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol.
What is the SMILES notation for 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol?
The canonical SMILES for 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol is CC(O)CCc1cn(C)c2cc3c(cc12)CN(C(C)C)C3.
What is the InChIKey of 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol?
The InChIKey is MNGLTTSYJDPYNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O/c1-12(2)20-10-15-7-17-14(6-5-13(3)21)9-19(4)18(17)8-16(15)11-20/h7-9,12-13,21H,5-6,10-11H2,1-4H3.
What are the key properties of 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol?
4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol has a molecular weight of 286.42 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-methyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)butan-2-ol is sourced from PubChem (CID 112540836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).