About 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one
4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one (PubChem CID 112540873) has the molecular formula C20H28N2O2
and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one.
Molecular Properties
| Compound Name | 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one |
| PubChem CID | 112540873 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one |
| SMILES | CC(=O)CCc1cn(C)c2cc3c(cc12)CN(CCOC(C)C)C3 |
| InChI | InChI=1S/C20H28N2O2/c1-14(2)24-8-7-22-12-17-9-19-16(6-5-15(3)23)11-21(4)20(19)10-18(17)13-22/h9-11,14H,5-8,12-13H2,1-4H3 |
| InChIKey | LIHAUUXXAZVIHG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one?
The IUPAC name of 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one (CID 112540873) is 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one.
What is the SMILES notation for 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one?
The canonical SMILES for 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one is CC(=O)CCc1cn(C)c2cc3c(cc12)CN(CCOC(C)C)C3.
What is the InChIKey of 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one?
The InChIKey is LIHAUUXXAZVIHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2O2/c1-14(2)24-8-7-22-12-17-9-19-16(6-5-15(3)23)11-21(4)20(19)10-18(17)13-22/h9-11,14H,5-8,12-13H2,1-4H3.
What are the key properties of 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one?
4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one has a molecular weight of 328.46 g/mol, XLogP of 3.44, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-methyl-6-(2-propan-2-yloxyethyl)-5,7-dihydropyrrolo[3,4-f]indol-3-yl]butan-2-one is sourced from PubChem (CID 112540873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).