About (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one
(2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 11254253) has the molecular formula C12H15BrO2
and a molecular weight of 271.15 g/mol. Its IUPAC name is (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one.
Molecular Properties
| Compound Name | (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one |
| PubChem CID | 11254253 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one |
| SMILES | CC(C)[C@H]1CC[C@]2(C=CC(=O)C(Br)=C2)O1 |
| InChI | InChI=1S/C12H15BrO2/c1-8(2)11-4-6-12(15-11)5-3-10(14)9(13)7-12/h3,5,7-8,11H,4,6H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | UZKVCDYSAKGPRP-NEPJUHHUSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one?
The IUPAC name of (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one (CID 11254253) is (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one.
What is the SMILES notation for (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one?
The canonical SMILES for (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one is CC(C)[C@H]1CC[C@]2(C=CC(=O)C(Br)=C2)O1.
What is the InChIKey of (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one?
The InChIKey is UZKVCDYSAKGPRP-NEPJUHHUSA-N. The full InChI is InChI=1S/C12H15BrO2/c1-8(2)11-4-6-12(15-11)5-3-10(14)9(13)7-12/h3,5,7-8,11H,4,6H2,1-2H3/t11-,12+/m1/s1.
What are the key properties of (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one?
(2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one has a molecular weight of 271.15 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-7-bromo-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one is sourced from PubChem (CID 11254253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).