methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate

C15H26N2O2 — CID 112543412

IUPACmethyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate
SMILESCOC(=O)NC1CC(CC2CC2)CN(CC2CC2)C1
InChIInChI=1S/C15H26N2O2/c1-19-15(18)16-14-7-13(6-11-2-3-11)9-17(10-14)8-12-4-5-12/h11-14H,2-10H2,1H3,(H,16,18)
InChIKeyZFFPASNNNGZBAN-UHFFFAOYSA-N
MW266.38 g/mol
LogP2.24
Rot. Bonds5

About methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate

methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate (PubChem CID 112543412) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate.

Molecular Properties

Compound Namemethyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate
PubChem CID112543412
Molecular FormulaC15H26N2O2
Molecular Weight266.38 g/mol
Exact Mass266.20
IUPAC Namemethyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate
SMILESCOC(=O)NC1CC(CC2CC2)CN(CC2CC2)C1
InChIInChI=1S/C15H26N2O2/c1-19-15(18)16-14-7-13(6-11-2-3-11)9-17(10-14)8-12-4-5-12/h11-14H,2-10H2,1H3,(H,16,18)
InChIKeyZFFPASNNNGZBAN-UHFFFAOYSA-N
XLogP2.24
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.38
LogP ≤ 52.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate?
The IUPAC name of methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate (CID 112543412) is methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate.
What is the SMILES notation for methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate?
The canonical SMILES for methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate is COC(=O)NC1CC(CC2CC2)CN(CC2CC2)C1.
What is the InChIKey of methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate?
The InChIKey is ZFFPASNNNGZBAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O2/c1-19-15(18)16-14-7-13(6-11-2-3-11)9-17(10-14)8-12-4-5-12/h11-14H,2-10H2,1H3,(H,16,18).
What are the key properties of methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate?
methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate has a molecular weight of 266.38 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[1,5-bis(cyclopropylmethyl)piperidin-3-yl]carbamate is sourced from PubChem (CID 112543412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).