C18H32O2 — CID 11254506
(4aR,7R)-1-butyl-7-(2-hydroxypropan-2-yl)-4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol (PubChem CID 11254506) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (4aR,7R)-1-butyl-7-(2-hydroxypropan-2-yl)-4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (4aR,7R)-1-butyl-7-(2-hydroxypropan-2-yl)-4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 11254506 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (4aR,7R)-1-butyl-7-(2-hydroxypropan-2-yl)-4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol |
| SMILES | CCCCC1=C2C[C@H](C(C)(C)O)CC[C@]2(C)CCC1O |
| InChI | InChI=1S/C18H32O2/c1-5-6-7-14-15-12-13(17(2,3)20)8-10-18(15,4)11-9-16(14)19/h13,16,19-20H,5-12H2,1-4H3/t13-,16?,18-/m1/s1 |
| InChIKey | OHDHVHWATRTFKW-DQYPLQBXSA-N |
| XLogP | 4.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|