C7H6F7N3O — CID 11254517
5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methoxy-1-methyl-1,2,4-triazole (PubChem CID 11254517) has the molecular formula C7H6F7N3O and a molecular weight of 281.13 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methoxy-1-methyl-1,2,4-triazole.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methoxy-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 11254517 |
| Molecular Formula | C7H6F7N3O |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methoxy-1-methyl-1,2,4-triazole |
| SMILES | COc1nc(C(F)(F)C(F)(F)C(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C7H6F7N3O/c1-17-3(15-4(16-17)18-2)5(8,9)6(10,11)7(12,13)14/h1-2H3 |
| InChIKey | BVTBRNKSLKEXBL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|