About 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid
3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid (PubChem CID 112545280) has the molecular formula C7H7NO2S
and a molecular weight of 169.20 g/mol. Its IUPAC name is 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid.
Molecular Properties
| Compound Name | 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid |
| PubChem CID | 112545280 |
| Molecular Formula | C7H7NO2S |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.02 |
| IUPAC Name | 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid |
| SMILES | O=C(O)c1[nH]cc2c1CCS2 |
| InChI | InChI=1S/C7H7NO2S/c9-7(10)6-4-1-2-11-5(4)3-8-6/h3,8H,1-2H2,(H,9,10) |
| InChIKey | PBMXCQZTGVLSTF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid?
The IUPAC name of 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid (CID 112545280) is 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid.
What is the SMILES notation for 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid?
The canonical SMILES for 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid is O=C(O)c1[nH]cc2c1CCS2.
What is the InChIKey of 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid?
The InChIKey is PBMXCQZTGVLSTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2S/c9-7(10)6-4-1-2-11-5(4)3-8-6/h3,8H,1-2H2,(H,9,10).
What are the key properties of 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid?
3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid has a molecular weight of 169.20 g/mol, XLogP of 1.36, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-carboxylic acid is sourced from PubChem (CID 112545280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).