C8H14N2O2 — CID 112545285
3-(2-hydroxypropyl)-1,4-dimethylimidazol-2-one (PubChem CID 112545285) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-(2-hydroxypropyl)-1,4-dimethylimidazol-2-one.
| Compound Name | 3-(2-hydroxypropyl)-1,4-dimethylimidazol-2-one |
|---|---|
| PubChem CID | 112545285 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-(2-hydroxypropyl)-1,4-dimethylimidazol-2-one |
| SMILES | Cc1cn(C)c(=O)n1CC(C)O |
| InChI | InChI=1S/C8H14N2O2/c1-6-4-9(3)8(12)10(6)5-7(2)11/h4,7,11H,5H2,1-3H3 |
| InChIKey | BERCRIUFTYGCHK-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |