pyrido[2,3-b]indolizine-10-carboxylic acid

C12H8N2O2 — CID 112545488

IUPACpyrido[2,3-b]indolizine-10-carboxylic acid
SMILESO=C(O)c1c2ncccc2n2ccccc12
InChIInChI=1S/C12H8N2O2/c15-12(16)10-8-4-1-2-7-14(8)9-5-3-6-13-11(9)10/h1-7H,(H,15,16)
InChIKeyDEQZLPIVWWBHFF-UHFFFAOYSA-N
MW212.21 g/mol
LogP2.19
Rot. Bonds1

About pyrido[2,3-b]indolizine-10-carboxylic acid

pyrido[2,3-b]indolizine-10-carboxylic acid (PubChem CID 112545488) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is pyrido[2,3-b]indolizine-10-carboxylic acid.

Molecular Properties

Compound Namepyrido[2,3-b]indolizine-10-carboxylic acid
PubChem CID112545488
Molecular FormulaC12H8N2O2
Molecular Weight212.21 g/mol
Exact Mass212.06
IUPAC Namepyrido[2,3-b]indolizine-10-carboxylic acid
SMILESO=C(O)c1c2ncccc2n2ccccc12
InChIInChI=1S/C12H8N2O2/c15-12(16)10-8-4-1-2-7-14(8)9-5-3-6-13-11(9)10/h1-7H,(H,15,16)
InChIKeyDEQZLPIVWWBHFF-UHFFFAOYSA-N
XLogP2.19
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.21
LogP ≤ 52.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze pyrido[2,3-b]indolizine-10-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pyrido[2,3-b]indolizine-10-carboxylic acid?
The IUPAC name of pyrido[2,3-b]indolizine-10-carboxylic acid (CID 112545488) is pyrido[2,3-b]indolizine-10-carboxylic acid.
What is the SMILES notation for pyrido[2,3-b]indolizine-10-carboxylic acid?
The canonical SMILES for pyrido[2,3-b]indolizine-10-carboxylic acid is O=C(O)c1c2ncccc2n2ccccc12.
What is the InChIKey of pyrido[2,3-b]indolizine-10-carboxylic acid?
The InChIKey is DEQZLPIVWWBHFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2/c15-12(16)10-8-4-1-2-7-14(8)9-5-3-6-13-11(9)10/h1-7H,(H,15,16).
What are the key properties of pyrido[2,3-b]indolizine-10-carboxylic acid?
pyrido[2,3-b]indolizine-10-carboxylic acid has a molecular weight of 212.21 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[2,3-b]indolizine-10-carboxylic acid is sourced from PubChem (CID 112545488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).