C11H18N2S — CID 112546583
[1-methyl-5-(3-methylthiophen-2-yl)pyrrolidin-3-yl]methanamine (PubChem CID 112546583) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is [1-methyl-5-(3-methylthiophen-2-yl)pyrrolidin-3-yl]methanamine.
| Compound Name | [1-methyl-5-(3-methylthiophen-2-yl)pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 112546583 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | [1-methyl-5-(3-methylthiophen-2-yl)pyrrolidin-3-yl]methanamine |
| SMILES | Cc1ccsc1C1CC(CN)CN1C |
| InChI | InChI=1S/C11H18N2S/c1-8-3-4-14-11(8)10-5-9(6-12)7-13(10)2/h3-4,9-10H,5-7,12H2,1-2H3 |
| InChIKey | CKQYJGPIVQTZOH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |