About 2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol
2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol (PubChem CID 112546953) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol.
Analyze 2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol?
The IUPAC name of 2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol (CID 112546953) is 2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol.
What is the SMILES notation for 2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol?
The canonical SMILES for 2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol is Cc1cccc2c1CCC(CCO)C2.
What is the InChIKey of 2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol?
The InChIKey is USGBRUUCRBAOMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-10-3-2-4-12-9-11(7-8-14)5-6-13(10)12/h2-4,11,14H,5-9H2,1H3.
What are the key properties of 2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol?
2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol has a molecular weight of 190.29 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol is sourced from PubChem (CID 112546953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).