C12H13FO — CID 112546957
2-(5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)acetaldehyde (PubChem CID 112546957) has the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. Its IUPAC name is 2-(5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)acetaldehyde.
| Compound Name | 2-(5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 112546957 |
| Molecular Formula | C12H13FO |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-(5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)acetaldehyde |
| SMILES | O=CCC1CCCc2c(F)cccc21 |
| InChI | InChI=1S/C12H13FO/c13-12-6-2-4-10-9(7-8-14)3-1-5-11(10)12/h2,4,6,8-9H,1,3,5,7H2 |
| InChIKey | BTPQTTAWQHXUBL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|