About 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol
2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol (PubChem CID 112546969) has the molecular formula C12H15FO
and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol.
Analyze 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol?
The IUPAC name of 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol (CID 112546969) is 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol.
What is the SMILES notation for 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol?
The canonical SMILES for 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol is OCCC1CCc2cccc(F)c2C1.
What is the InChIKey of 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol?
The InChIKey is QHTRANIVSLNLCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO/c13-12-3-1-2-10-5-4-9(6-7-14)8-11(10)12/h1-3,9,14H,4-8H2.
What are the key properties of 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol?
2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol has a molecular weight of 194.25 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)ethanol is sourced from PubChem (CID 112546969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).