About 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one
3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 112547546) has the molecular formula C11H14BrNO
and a molecular weight of 256.14 g/mol. Its IUPAC name is 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one.
Molecular Properties
| Compound Name | 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one |
| PubChem CID | 112547546 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | CCn1c2c(cc(Br)c1=O)CCCC2 |
| InChI | InChI=1S/C11H14BrNO/c1-2-13-10-6-4-3-5-8(10)7-9(12)11(13)14/h7H,2-6H2,1H3 |
| InChIKey | PWBNCEJWOLCYMC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one?
The IUPAC name of 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one (CID 112547546) is 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one.
What is the SMILES notation for 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one?
The canonical SMILES for 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one is CCn1c2c(cc(Br)c1=O)CCCC2.
What is the InChIKey of 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one?
The InChIKey is PWBNCEJWOLCYMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrNO/c1-2-13-10-6-4-3-5-8(10)7-9(12)11(13)14/h7H,2-6H2,1H3.
What are the key properties of 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one?
3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one has a molecular weight of 256.14 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one is sourced from PubChem (CID 112547546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).