C16H19NO4 — CID 11254766
(3aR,5S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenyl-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazole (PubChem CID 11254766) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (3aR,5S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenyl-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazole.
| Compound Name | (3aR,5S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenyl-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazole |
|---|---|
| PubChem CID | 11254766 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (3aR,5S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenyl-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazole |
| SMILES | CC1(C)OC[C@H]([C@@H]2C[C@H]3N=C(c4ccccc4)O[C@H]3O2)O1 |
| InChI | InChI=1S/C16H19NO4/c1-16(2)18-9-13(21-16)12-8-11-15(19-12)20-14(17-11)10-6-4-3-5-7-10/h3-7,11-13,15H,8-9H2,1-2H3/t11-,12+,13-,15-/m1/s1 |
| InChIKey | QWLGHGQEZYVUTR-QVHKTLOISA-N |
| XLogP | 2.10 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |