C14H20N2O3 — CID 112547774
5-[(3-amino-4-methylbenzoyl)amino]-2-methylpentanoic acid (PubChem CID 112547774) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 5-[(3-amino-4-methylbenzoyl)amino]-2-methylpentanoic acid.
| Compound Name | 5-[(3-amino-4-methylbenzoyl)amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 112547774 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 5-[(3-amino-4-methylbenzoyl)amino]-2-methylpentanoic acid |
| SMILES | Cc1ccc(C(=O)NCCCC(C)C(=O)O)cc1N |
| InChI | InChI=1S/C14H20N2O3/c1-9-5-6-11(8-12(9)15)13(17)16-7-3-4-10(2)14(18)19/h5-6,8,10H,3-4,7,15H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | SRHZLBXCJODEEN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|