C17H28O2Si — CID 11254842
(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-prop-2-enyl-3,4,5,6-tetrahydro-2H-pentalen-1-one (PubChem CID 11254842) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-prop-2-enyl-3,4,5,6-tetrahydro-2H-pentalen-1-one.
| Compound Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-prop-2-enyl-3,4,5,6-tetrahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 11254842 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-prop-2-enyl-3,4,5,6-tetrahydro-2H-pentalen-1-one |
| SMILES | C=CC[C@H]1CC(=O)C2=C1[C@@H](O[Si](C)(C)C(C)(C)C)CC2 |
| InChI | InChI=1S/C17H28O2Si/c1-7-8-12-11-14(18)13-9-10-15(16(12)13)19-20(5,6)17(2,3)4/h7,12,15H,1,8-11H2,2-6H3/t12-,15-/m0/s1 |
| InChIKey | WLUOJRDWOVWVNZ-WFASDCNBSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|