C19H21NO2 — CID 11254917
(6aS,12aR)-9-methoxy-7,7-dimethyl-6,6a,12,12a-tetrahydrochromeno[4,3-b]quinoline (PubChem CID 11254917) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (6aS,12aR)-9-methoxy-7,7-dimethyl-6,6a,12,12a-tetrahydrochromeno[4,3-b]quinoline.
| Compound Name | (6aS,12aR)-9-methoxy-7,7-dimethyl-6,6a,12,12a-tetrahydrochromeno[4,3-b]quinoline |
|---|---|
| PubChem CID | 11254917 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (6aS,12aR)-9-methoxy-7,7-dimethyl-6,6a,12,12a-tetrahydrochromeno[4,3-b]quinoline |
| SMILES | COc1ccc2c(c1)C(C)(C)[C@@H]1COc3ccccc3[C@@H]1N2 |
| InChI | InChI=1S/C19H21NO2/c1-19(2)14-10-12(21-3)8-9-16(14)20-18-13-6-4-5-7-17(13)22-11-15(18)19/h4-10,15,18,20H,11H2,1-3H3/t15-,18+/m1/s1 |
| InChIKey | HYGVVSYIDDWCNA-QAPCUYQASA-N |
| XLogP | 4.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|