C10H11N3O5S — CID 112550884
N-(2-amino-2-oxoethoxy)-5-methylsulfanyl-2-nitrobenzamide (PubChem CID 112550884) has the molecular formula C10H11N3O5S and a molecular weight of 285.28 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-5-methylsulfanyl-2-nitrobenzamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-5-methylsulfanyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 112550884 |
| Molecular Formula | C10H11N3O5S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-5-methylsulfanyl-2-nitrobenzamide |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)NOCC(N)=O)c1 |
| InChI | InChI=1S/C10H11N3O5S/c1-19-6-2-3-8(13(16)17)7(4-6)10(15)12-18-5-9(11)14/h2-4H,5H2,1H3,(H2,11,14)(H,12,15) |
| InChIKey | YGYBBUBQSNNHJG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|