C11H16ClFN2S — CID 112551382
5-chloro-3-fluoro-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyridin-2-amine (PubChem CID 112551382) has the molecular formula C11H16ClFN2S and a molecular weight of 262.78 g/mol. Its IUPAC name is 5-chloro-3-fluoro-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyridin-2-amine.
| Compound Name | 5-chloro-3-fluoro-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 112551382 |
| Molecular Formula | C11H16ClFN2S |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 5-chloro-3-fluoro-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyridin-2-amine |
| SMILES | CCC(CSC)N(C)c1ncc(Cl)cc1F |
| InChI | InChI=1S/C11H16ClFN2S/c1-4-9(7-16-3)15(2)11-10(13)5-8(12)6-14-11/h5-6,9H,4,7H2,1-3H3 |
| InChIKey | IXCONQLZNQTRQL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |