C20H32O2 — CID 11255167
2-[(1R,3aS,9E,12E)-10-(hydroxymethyl)-3a-methyl-6-methylidene-1,2,3,4,5,7,8,11-octahydrocyclopenta[11]annulen-1-yl]propan-2-ol (PubChem CID 11255167) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 2-[(1R,3aS,9E,12E)-10-(hydroxymethyl)-3a-methyl-6-methylidene-1,2,3,4,5,7,8,11-octahydrocyclopenta[11]annulen-1-yl]propan-2-ol.
| Compound Name | 2-[(1R,3aS,9E,12E)-10-(hydroxymethyl)-3a-methyl-6-methylidene-1,2,3,4,5,7,8,11-octahydrocyclopenta[11]annulen-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 11255167 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 2-[(1R,3aS,9E,12E)-10-(hydroxymethyl)-3a-methyl-6-methylidene-1,2,3,4,5,7,8,11-octahydrocyclopenta[11]annulen-1-yl]propan-2-ol |
| SMILES | C=C1CC/C=C(/CO)C/C=C2\[C@H](C(C)(C)O)CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C20H32O2/c1-15-6-5-7-16(14-21)8-9-18-17(19(2,3)22)11-13-20(18,4)12-10-15/h7,9,17,21-22H,1,5-6,8,10-14H2,2-4H3/b16-7+,18-9+/t17-,20-/m1/s1 |
| InChIKey | YNKXGNNMIQFXGP-PGFRGAQJSA-N |
| XLogP | 4.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|