About 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide
4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide (PubChem CID 1125524) has the molecular formula C12H14Br2N2O4S
and a molecular weight of 442.13 g/mol. Its IUPAC name is 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide |
| PubChem CID | 1125524 |
| Molecular Formula | C12H14Br2N2O4S |
| Molecular Weight | 442.13 g/mol |
| Exact Mass | 439.90 |
| IUPAC Name | 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide |
| SMILES | Nc1c(Br)cc(S(=O)(=O)N(C[C@@H]2CO2)C[C@@H]2CO2)cc1Br |
| InChI | InChI=1S/C12H14Br2N2O4S/c13-10-1-9(2-11(14)12(10)15)21(17,18)16(3-7-5-19-7)4-8-6-20-8/h1-2,7-8H,3-6,15H2/t7-,8-/m1/s1 |
| InChIKey | WNHUKSCLSZCIGE-HTQZYQBOSA-N |
| XLogP | 1.58 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.13 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide?
The IUPAC name of 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide (CID 1125524) is 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide.
What is the SMILES notation for 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide?
The canonical SMILES for 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide is Nc1c(Br)cc(S(=O)(=O)N(C[C@@H]2CO2)C[C@@H]2CO2)cc1Br.
What is the InChIKey of 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide?
The InChIKey is WNHUKSCLSZCIGE-HTQZYQBOSA-N. The full InChI is InChI=1S/C12H14Br2N2O4S/c13-10-1-9(2-11(14)12(10)15)21(17,18)16(3-7-5-19-7)4-8-6-20-8/h1-2,7-8H,3-6,15H2/t7-,8-/m1/s1.
What are the key properties of 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide?
4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide has a molecular weight of 442.13 g/mol, XLogP of 1.58, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5-dibromo-N,N-bis[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide is sourced from PubChem (CID 1125524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).