C14H21N3O2S — CID 112552507
N,6-diethyl-3-propylimidazo[1,5-a]pyridine-1-sulfonamide (PubChem CID 112552507) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is N,6-diethyl-3-propylimidazo[1,5-a]pyridine-1-sulfonamide.
| Compound Name | N,6-diethyl-3-propylimidazo[1,5-a]pyridine-1-sulfonamide |
|---|---|
| PubChem CID | 112552507 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N,6-diethyl-3-propylimidazo[1,5-a]pyridine-1-sulfonamide |
| SMILES | CCCc1nc(S(=O)(=O)NCC)c2ccc(CC)cn12 |
| InChI | InChI=1S/C14H21N3O2S/c1-4-7-13-16-14(20(18,19)15-6-3)12-9-8-11(5-2)10-17(12)13/h8-10,15H,4-7H2,1-3H3 |
| InChIKey | XQYRPOAZFJCGFS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |