C14H23N3O — CID 112552665
N,N,7-trimethyl-3-propan-2-yl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 112552665) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N,N,7-trimethyl-3-propan-2-yl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | N,N,7-trimethyl-3-propan-2-yl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 112552665 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N,N,7-trimethyl-3-propan-2-yl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | CC1CCn2c(C(C)C)nc(C(=O)N(C)C)c2C1 |
| InChI | InChI=1S/C14H23N3O/c1-9(2)13-15-12(14(18)16(4)5)11-8-10(3)6-7-17(11)13/h9-10H,6-8H2,1-5H3 |
| InChIKey | KCBHKNIZLRHFFC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |