C12H19BrN2 — CID 112552895
1-(bromomethyl)-8-methyl-3-propyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine (PubChem CID 112552895) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 1-(bromomethyl)-8-methyl-3-propyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine.
| Compound Name | 1-(bromomethyl)-8-methyl-3-propyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 112552895 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-(bromomethyl)-8-methyl-3-propyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine |
| SMILES | CCCc1nc(CBr)c2n1CCCC2C |
| InChI | InChI=1S/C12H19BrN2/c1-3-5-11-14-10(8-13)12-9(2)6-4-7-15(11)12/h9H,3-8H2,1-2H3 |
| InChIKey | KSHSCCAGXNODIN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|