C15H22BrNO2 — CID 112553577
4-bromo-2-methyl-6-[(2,2,6-trimethylmorpholin-4-yl)methyl]phenol (PubChem CID 112553577) has the molecular formula C15H22BrNO2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 4-bromo-2-methyl-6-[(2,2,6-trimethylmorpholin-4-yl)methyl]phenol.
| Compound Name | 4-bromo-2-methyl-6-[(2,2,6-trimethylmorpholin-4-yl)methyl]phenol |
|---|---|
| PubChem CID | 112553577 |
| Molecular Formula | C15H22BrNO2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-bromo-2-methyl-6-[(2,2,6-trimethylmorpholin-4-yl)methyl]phenol |
| SMILES | Cc1cc(Br)cc(CN2CC(C)OC(C)(C)C2)c1O |
| InChI | InChI=1S/C15H22BrNO2/c1-10-5-13(16)6-12(14(10)18)8-17-7-11(2)19-15(3,4)9-17/h5-6,11,18H,7-9H2,1-4H3 |
| InChIKey | ZNJXTQPAMHMZNF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|