C14H20ClNO2 — CID 112554358
2-chloro-6-[(2-cyclopentyloxyethylamino)methyl]phenol (PubChem CID 112554358) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 2-chloro-6-[(2-cyclopentyloxyethylamino)methyl]phenol.
| Compound Name | 2-chloro-6-[(2-cyclopentyloxyethylamino)methyl]phenol |
|---|---|
| PubChem CID | 112554358 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-chloro-6-[(2-cyclopentyloxyethylamino)methyl]phenol |
| SMILES | Oc1c(Cl)cccc1CNCCOC1CCCC1 |
| InChI | InChI=1S/C14H20ClNO2/c15-13-7-3-4-11(14(13)17)10-16-8-9-18-12-5-1-2-6-12/h3-4,7,12,16-17H,1-2,5-6,8-10H2 |
| InChIKey | WOYZXCZSWMMVPT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|