C17H19NO — CID 112554699
2-[(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylamino)methyl]-6-methylphenol (PubChem CID 112554699) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-[(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylamino)methyl]-6-methylphenol.
| Compound Name | 2-[(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylamino)methyl]-6-methylphenol |
|---|---|
| PubChem CID | 112554699 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-[(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylamino)methyl]-6-methylphenol |
| SMILES | Cc1cccc(CNCC2Cc3ccccc32)c1O |
| InChI | InChI=1S/C17H19NO/c1-12-5-4-7-14(17(12)19)10-18-11-15-9-13-6-2-3-8-16(13)15/h2-8,15,18-19H,9-11H2,1H3 |
| InChIKey | MMNPLGBMABVSJA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|