C10H11N3O3S — CID 112555181
3-(pyridazine-4-carbonylamino)thiolane-3-carboxylic acid (PubChem CID 112555181) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is 3-(pyridazine-4-carbonylamino)thiolane-3-carboxylic acid.
| Compound Name | 3-(pyridazine-4-carbonylamino)thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 112555181 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-(pyridazine-4-carbonylamino)thiolane-3-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCSC1)c1ccnnc1 |
| InChI | InChI=1S/C10H11N3O3S/c14-8(7-1-3-11-12-5-7)13-10(9(15)16)2-4-17-6-10/h1,3,5H,2,4,6H2,(H,13,14)(H,15,16) |
| InChIKey | ZXDVGEDRTBKBCJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |