C16H19N3 — CID 112555680
6,12-dimethyl-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),7,10(15),11,13-pentaen-4-amine (PubChem CID 112555680) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 6,12-dimethyl-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),7,10(15),11,13-pentaen-4-amine.
| Compound Name | 6,12-dimethyl-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),7,10(15),11,13-pentaen-4-amine |
|---|---|
| PubChem CID | 112555680 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 6,12-dimethyl-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),7,10(15),11,13-pentaen-4-amine |
| SMILES | Cc1ccc2c(c1)-c1nc3n(c1C2)CC(N)CC3C |
| InChI | InChI=1S/C16H19N3/c1-9-3-4-11-7-14-15(13(11)5-9)18-16-10(2)6-12(17)8-19(14)16/h3-5,10,12H,6-8,17H2,1-2H3 |
| InChIKey | WKCVYYKMLUMURY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |