About 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid
5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid (PubChem CID 112555753) has the molecular formula C12H19N3O3S
and a molecular weight of 285.37 g/mol. Its IUPAC name is 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid |
| PubChem CID | 112555753 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1nsc(N(C)C(=O)C(N)C(C)(C)C)c1C(=O)O |
| InChI | InChI=1S/C12H19N3O3S/c1-6-7(11(17)18)10(19-14-6)15(5)9(16)8(13)12(2,3)4/h8H,13H2,1-5H3,(H,17,18) |
| InChIKey | WTLMKJUMJNOYAK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid (CID 112555753) is 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid is Cc1nsc(N(C)C(=O)C(N)C(C)(C)C)c1C(=O)O.
What is the InChIKey of 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid?
The InChIKey is WTLMKJUMJNOYAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3S/c1-6-7(11(17)18)10(19-14-6)15(5)9(16)8(13)12(2,3)4/h8H,13H2,1-5H3,(H,17,18).
What are the key properties of 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid?
5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid has a molecular weight of 285.37 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 112555753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).