About 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine
1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine (PubChem CID 112556492) has the molecular formula C12H15F2N3
and a molecular weight of 239.27 g/mol. Its IUPAC name is 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine.
Molecular Properties
| Compound Name | 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine |
| PubChem CID | 112556492 |
| Molecular Formula | C12H15F2N3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine |
| SMILES | CC(C)CC(N)c1nc2c(F)c(F)ccc2[nH]1 |
| InChI | InChI=1S/C12H15F2N3/c1-6(2)5-8(15)12-16-9-4-3-7(13)10(14)11(9)17-12/h3-4,6,8H,5,15H2,1-2H3,(H,16,17) |
| InChIKey | XEHKCIXTFUJQDV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine?
The IUPAC name of 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine (CID 112556492) is 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine.
What is the SMILES notation for 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine?
The canonical SMILES for 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine is CC(C)CC(N)c1nc2c(F)c(F)ccc2[nH]1.
What is the InChIKey of 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine?
The InChIKey is XEHKCIXTFUJQDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N3/c1-6(2)5-8(15)12-16-9-4-3-7(13)10(14)11(9)17-12/h3-4,6,8H,5,15H2,1-2H3,(H,16,17).
What are the key properties of 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine?
1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine has a molecular weight of 239.27 g/mol, XLogP of 2.89, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-difluoro-1H-benzimidazol-2-yl)-3-methylbutan-1-amine is sourced from PubChem (CID 112556492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).