About 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol
4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol (PubChem CID 112556656) has the molecular formula C14H10F2N2O
and a molecular weight of 260.24 g/mol. Its IUPAC name is 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol.
Molecular Properties
| Compound Name | 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol |
| PubChem CID | 112556656 |
| Molecular Formula | C14H10F2N2O |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol |
| SMILES | Oc1ccc(Cc2nc3c(F)c(F)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C14H10F2N2O/c15-10-5-6-11-14(13(10)16)18-12(17-11)7-8-1-3-9(19)4-2-8/h1-6,19H,7H2,(H,17,18) |
| InChIKey | RSKCBNPPPHBKIG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol?
The IUPAC name of 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol (CID 112556656) is 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol.
What is the SMILES notation for 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol?
The canonical SMILES for 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol is Oc1ccc(Cc2nc3c(F)c(F)ccc3[nH]2)cc1.
What is the InChIKey of 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol?
The InChIKey is RSKCBNPPPHBKIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2N2O/c15-10-5-6-11-14(13(10)16)18-12(17-11)7-8-1-3-9(19)4-2-8/h1-6,19H,7H2,(H,17,18).
What are the key properties of 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol?
4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol has a molecular weight of 260.24 g/mol, XLogP of 3.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]phenol is sourced from PubChem (CID 112556656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).