3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid

C10H9NO3S — CID 112556961

IUPAC3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid
SMILESO=C(O)CCn1ccc2sccc2c1=O
InChIInChI=1S/C10H9NO3S/c12-9(13)2-5-11-4-1-8-7(10(11)14)3-6-15-8/h1,3-4,6H,2,5H2,(H,12,13)
InChIKeyLBORXBZSZQTMGJ-UHFFFAOYSA-N
MW223.25 g/mol
LogP1.54
Rot. Bonds3

About 3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid

3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid (PubChem CID 112556961) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is 3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid.

Molecular Properties

Compound Name3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid
PubChem CID112556961
Molecular FormulaC10H9NO3S
Molecular Weight223.25 g/mol
Exact Mass223.03
IUPAC Name3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid
SMILESO=C(O)CCn1ccc2sccc2c1=O
InChIInChI=1S/C10H9NO3S/c12-9(13)2-5-11-4-1-8-7(10(11)14)3-6-15-8/h1,3-4,6H,2,5H2,(H,12,13)
InChIKeyLBORXBZSZQTMGJ-UHFFFAOYSA-N
XLogP1.54
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.25
LogP ≤ 51.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid?
The IUPAC name of 3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid (CID 112556961) is 3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid.
What is the SMILES notation for 3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid?
The canonical SMILES for 3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid is O=C(O)CCn1ccc2sccc2c1=O.
What is the InChIKey of 3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid?
The InChIKey is LBORXBZSZQTMGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3S/c12-9(13)2-5-11-4-1-8-7(10(11)14)3-6-15-8/h1,3-4,6H,2,5H2,(H,12,13).
What are the key properties of 3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid?
3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid has a molecular weight of 223.25 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-oxothieno[3,2-c]pyridin-5-yl)propanoic acid is sourced from PubChem (CID 112556961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).