C16H24ClN5 — CID 11255710
1-(3-chlorophenyl)-2-heptyl-2H-1,3,5-triazine-4,6-diamine (PubChem CID 11255710) has the molecular formula C16H24ClN5 and a molecular weight of 321.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-heptyl-2H-1,3,5-triazine-4,6-diamine.
| Compound Name | 1-(3-chlorophenyl)-2-heptyl-2H-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 11255710 |
| Molecular Formula | C16H24ClN5 |
| Molecular Weight | 321.86 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-(3-chlorophenyl)-2-heptyl-2H-1,3,5-triazine-4,6-diamine |
| SMILES | CCCCCCCC1N=C(N)N=C(N)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H24ClN5/c1-2-3-4-5-6-10-14-20-15(18)21-16(19)22(14)13-9-7-8-12(17)11-13/h7-9,11,14H,2-6,10H2,1H3,(H4,18,19,20,21) |
| InChIKey | INPCCFXNOLNBBO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.86 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|