C17H19F3OSi — CID 11255795
trimethyl-(2,2,2-trifluoro-1,1-diphenylethoxy)silane (PubChem CID 11255795) has the molecular formula C17H19F3OSi and a molecular weight of 324.42 g/mol. Its IUPAC name is trimethyl-(2,2,2-trifluoro-1,1-diphenylethoxy)silane.
| Compound Name | trimethyl-(2,2,2-trifluoro-1,1-diphenylethoxy)silane |
|---|---|
| PubChem CID | 11255795 |
| Molecular Formula | C17H19F3OSi |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | trimethyl-(2,2,2-trifluoro-1,1-diphenylethoxy)silane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H19F3OSi/c1-22(2,3)21-16(17(18,19)20,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3 |
| InChIKey | JWYIWQRVJAYVJT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|