C16H23NO2 — CID 112558530
3,3-dimethylbutyl 1-(4-aminophenyl)cyclopropane-1-carboxylate (PubChem CID 112558530) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 3,3-dimethylbutyl 1-(4-aminophenyl)cyclopropane-1-carboxylate.
| Compound Name | 3,3-dimethylbutyl 1-(4-aminophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 112558530 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 3,3-dimethylbutyl 1-(4-aminophenyl)cyclopropane-1-carboxylate |
| SMILES | CC(C)(C)CCOC(=O)C1(c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C16H23NO2/c1-15(2,3)10-11-19-14(18)16(8-9-16)12-4-6-13(17)7-5-12/h4-7H,8-11,17H2,1-3H3 |
| InChIKey | FKYJMTBWXTZCBU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|